C25H20F2N4O2 — CID 134264536
1-[3-[7-(2,3-difluoro-4-pyridin-2-yloxyphenyl)pyrrolo[1,2-c]pyrimidin-5-yl]pyrrolidin-1-yl]prop-2-en-1-one (PubChem CID 134264536) has the molecular formula C25H20F2N4O2 and a molecular weight of 446.46 g/mol. Its IUPAC name is 1-[3-[7-(2,3-difluoro-4-pyridin-2-yloxyphenyl)pyrrolo[1,2-c]pyrimidin-5-yl]pyrrolidin-1-yl]prop-2-en-1-one.
| Compound Name | 1-[3-[7-(2,3-difluoro-4-pyridin-2-yloxyphenyl)pyrrolo[1,2-c]pyrimidin-5-yl]pyrrolidin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 134264536 |
| Molecular Formula | C25H20F2N4O2 |
| Molecular Weight | 446.46 g/mol |
| Exact Mass | 446.16 |
| IUPAC Name | 1-[3-[7-(2,3-difluoro-4-pyridin-2-yloxyphenyl)pyrrolo[1,2-c]pyrimidin-5-yl]pyrrolidin-1-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1CCC(c2cc(-c3ccc(Oc4ccccn4)c(F)c3F)n3cnccc23)C1 |
| InChI | InChI=1S/C25H20F2N4O2/c1-2-23(32)30-12-9-16(14-30)18-13-20(31-15-28-11-8-19(18)31)17-6-7-21(25(27)24(17)26)33-22-5-3-4-10-29-22/h2-8,10-11,13,15-16H,1,9,12,14H2 |
| InChIKey | ZWBHONZRRKZNPC-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 59.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.46 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|