C28H19FN4O2 — CID 134264823
N-[3-[6-[6-(3-fluorophenoxy)-3-pyridinyl]quinazolin-8-yl]phenyl]prop-2-enamide (PubChem CID 134264823) has the molecular formula C28H19FN4O2 and a molecular weight of 462.48 g/mol. Its IUPAC name is N-[3-[6-[6-(3-fluorophenoxy)-3-pyridinyl]quinazolin-8-yl]phenyl]prop-2-enamide.
| Compound Name | N-[3-[6-[6-(3-fluorophenoxy)-3-pyridinyl]quinazolin-8-yl]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 134264823 |
| Molecular Formula | C28H19FN4O2 |
| Molecular Weight | 462.48 g/mol |
| Exact Mass | 462.15 |
| IUPAC Name | N-[3-[6-[6-(3-fluorophenoxy)-3-pyridinyl]quinazolin-8-yl]phenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1cccc(-c2cc(-c3ccc(Oc4cccc(F)c4)nc3)cc3cncnc23)c1 |
| InChI | InChI=1S/C28H19FN4O2/c1-2-26(34)33-23-7-3-5-18(12-23)25-13-20(11-21-15-30-17-32-28(21)25)19-9-10-27(31-16-19)35-24-8-4-6-22(29)14-24/h2-17H,1H2,(H,33,34) |
| InChIKey | HQCNRHNULPKTMN-UHFFFAOYSA-N |
| XLogP | 6.41 |
| TPSA | 77.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.48 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|