C23H15FN4O — CID 134276293
N-[3-[6-(3-fluorophenyl)quinazolin-8-yl]phenyl]-3-iminoprop-2-enamide (PubChem CID 134276293) has the molecular formula C23H15FN4O and a molecular weight of 382.40 g/mol. Its IUPAC name is N-[3-[6-(3-fluorophenyl)quinazolin-8-yl]phenyl]-3-iminoprop-2-enamide.
| Compound Name | N-[3-[6-(3-fluorophenyl)quinazolin-8-yl]phenyl]-3-iminoprop-2-enamide |
|---|---|
| PubChem CID | 134276293 |
| Molecular Formula | C23H15FN4O |
| Molecular Weight | 382.40 g/mol |
| Exact Mass | 382.12 |
| IUPAC Name | N-[3-[6-(3-fluorophenyl)quinazolin-8-yl]phenyl]-3-iminoprop-2-enamide |
| SMILES | N=C=CC(=O)Nc1cccc(-c2cc(-c3cccc(F)c3)cc3cncnc23)c1 |
| InChI | InChI=1S/C23H15FN4O/c24-19-5-1-3-15(10-19)17-9-18-13-26-14-27-23(18)21(12-17)16-4-2-6-20(11-16)28-22(29)7-8-25/h1-7,9-14,25H,(H,28,29) |
| InChIKey | PKAKKQOJVGMXFE-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 78.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.40 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|