C24H17N3O3 — CID 146637171
4-[8-[3-(prop-2-enoylamino)phenyl]quinazolin-6-yl]benzoic acid (PubChem CID 146637171) has the molecular formula C24H17N3O3 and a molecular weight of 395.42 g/mol. Its IUPAC name is 4-[8-[3-(prop-2-enoylamino)phenyl]quinazolin-6-yl]benzoic acid.
| Compound Name | 4-[8-[3-(prop-2-enoylamino)phenyl]quinazolin-6-yl]benzoic acid |
|---|---|
| PubChem CID | 146637171 |
| Molecular Formula | C24H17N3O3 |
| Molecular Weight | 395.42 g/mol |
| Exact Mass | 395.13 |
| IUPAC Name | 4-[8-[3-(prop-2-enoylamino)phenyl]quinazolin-6-yl]benzoic acid |
| SMILES | C=CC(=O)Nc1cccc(-c2cc(-c3ccc(C(=O)O)cc3)cc3cncnc23)c1 |
| InChI | InChI=1S/C24H17N3O3/c1-2-22(28)27-20-5-3-4-17(11-20)21-12-18(10-19-13-25-14-26-23(19)21)15-6-8-16(9-7-15)24(29)30/h2-14H,1H2,(H,27,28)(H,29,30) |
| InChIKey | KFBHOTWIJPJQKM-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 92.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.42 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|