C30H24N6O2 — CID 134265085
4-[2-amino-8-[3-(prop-2-enoylamino)phenyl]quinazolin-6-yl]-N-(4-methyl-2-pyridinyl)benzamide (PubChem CID 134265085) has the molecular formula C30H24N6O2 and a molecular weight of 500.56 g/mol. Its IUPAC name is 4-[2-amino-8-[3-(prop-2-enoylamino)phenyl]quinazolin-6-yl]-N-(4-methyl-2-pyridinyl)benzamide.
| Compound Name | 4-[2-amino-8-[3-(prop-2-enoylamino)phenyl]quinazolin-6-yl]-N-(4-methyl-2-pyridinyl)benzamide |
|---|---|
| PubChem CID | 134265085 |
| Molecular Formula | C30H24N6O2 |
| Molecular Weight | 500.56 g/mol |
| Exact Mass | 500.20 |
| IUPAC Name | 4-[2-amino-8-[3-(prop-2-enoylamino)phenyl]quinazolin-6-yl]-N-(4-methyl-2-pyridinyl)benzamide |
| SMILES | C=CC(=O)Nc1cccc(-c2cc(-c3ccc(C(=O)Nc4cc(C)ccn4)cc3)cc3cnc(N)nc23)c1 |
| InChI | InChI=1S/C30H24N6O2/c1-3-27(37)34-24-6-4-5-21(15-24)25-16-22(14-23-17-33-30(31)36-28(23)25)19-7-9-20(10-8-19)29(38)35-26-13-18(2)11-12-32-26/h3-17H,1H2,2H3,(H,34,37)(H2,31,33,36)(H,32,35,38) |
| InChIKey | FKVPWUHBZFVGAB-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 122.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.56 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|