C27H19N5O4 — CID 146637162
N-[3-[2-amino-6-[4-[(4-oxo-1H-pyridin-2-yl)oxy]phenyl]quinazolin-8-yl]phenyl]-2-oxoacetamide (PubChem CID 146637162) has the molecular formula C27H19N5O4 and a molecular weight of 477.48 g/mol. Its IUPAC name is N-[3-[2-amino-6-[4-[(4-oxo-1H-pyridin-2-yl)oxy]phenyl]quinazolin-8-yl]phenyl]-2-oxoacetamide.
| Compound Name | N-[3-[2-amino-6-[4-[(4-oxo-1H-pyridin-2-yl)oxy]phenyl]quinazolin-8-yl]phenyl]-2-oxoacetamide |
|---|---|
| PubChem CID | 146637162 |
| Molecular Formula | C27H19N5O4 |
| Molecular Weight | 477.48 g/mol |
| Exact Mass | 477.14 |
| IUPAC Name | N-[3-[2-amino-6-[4-[(4-oxo-1H-pyridin-2-yl)oxy]phenyl]quinazolin-8-yl]phenyl]-2-oxoacetamide |
| SMILES | Nc1ncc2cc(-c3ccc(Oc4cc(=O)cc[nH]4)cc3)cc(-c3cccc(NC(=O)C=O)c3)c2n1 |
| InChI | InChI=1S/C27H19N5O4/c28-27-30-14-19-10-18(16-4-6-22(7-5-16)36-25-13-21(34)8-9-29-25)12-23(26(19)32-27)17-2-1-3-20(11-17)31-24(35)15-33/h1-15H,(H,29,34)(H,31,35)(H2,28,30,32) |
| InChIKey | JHHLUORPNNOHQU-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 140.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.48 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|