C28H26FN5O2 — CID 167083040
N-[3-[2-amino-6-[(3R)-3-fluoro-4-pyridin-2-yloxycyclohexyl]quinazolin-8-yl]phenyl]prop-2-enamide (PubChem CID 167083040) has the molecular formula C28H26FN5O2 and a molecular weight of 483.55 g/mol. Its IUPAC name is N-[3-[2-amino-6-[(3R)-3-fluoro-4-pyridin-2-yloxycyclohexyl]quinazolin-8-yl]phenyl]prop-2-enamide.
| Compound Name | N-[3-[2-amino-6-[(3R)-3-fluoro-4-pyridin-2-yloxycyclohexyl]quinazolin-8-yl]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 167083040 |
| Molecular Formula | C28H26FN5O2 |
| Molecular Weight | 483.55 g/mol |
| Exact Mass | 483.21 |
| IUPAC Name | N-[3-[2-amino-6-[(3R)-3-fluoro-4-pyridin-2-yloxycyclohexyl]quinazolin-8-yl]phenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1cccc(-c2cc(C3CCC(Oc4ccccn4)[C@H](F)C3)cc3cnc(N)nc23)c1 |
| InChI | InChI=1S/C28H26FN5O2/c1-2-25(35)33-21-7-5-6-18(13-21)22-14-19(12-20-16-32-28(30)34-27(20)22)17-9-10-24(23(29)15-17)36-26-8-3-4-11-31-26/h2-8,11-14,16-17,23-24H,1,9-10,15H2,(H,33,35)(H2,30,32,34)/t17?,23-,24?/m1/s1 |
| InChIKey | AFKLBVUXCSSKFC-OVOLAFONSA-N |
| XLogP | 5.45 |
| TPSA | 103.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.55 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|