C30H25N5O2 — CID 167083047
8-[3-(buta-1,3-dien-2-ylamino)phenyl]-6-(2-methoxy-4-pyridin-2-yloxyphenyl)quinazolin-2-amine (PubChem CID 167083047) has the molecular formula C30H25N5O2 and a molecular weight of 487.56 g/mol. Its IUPAC name is 8-[3-(buta-1,3-dien-2-ylamino)phenyl]-6-(2-methoxy-4-pyridin-2-yloxyphenyl)quinazolin-2-amine.
| Compound Name | 8-[3-(buta-1,3-dien-2-ylamino)phenyl]-6-(2-methoxy-4-pyridin-2-yloxyphenyl)quinazolin-2-amine |
|---|---|
| PubChem CID | 167083047 |
| Molecular Formula | C30H25N5O2 |
| Molecular Weight | 487.56 g/mol |
| Exact Mass | 487.20 |
| IUPAC Name | 8-[3-(buta-1,3-dien-2-ylamino)phenyl]-6-(2-methoxy-4-pyridin-2-yloxyphenyl)quinazolin-2-amine |
| SMILES | C=CC(=C)Nc1cccc(-c2cc(-c3ccc(Oc4ccccn4)cc3OC)cc3cnc(N)nc23)c1 |
| InChI | InChI=1S/C30H25N5O2/c1-4-19(2)34-23-9-7-8-20(15-23)26-16-21(14-22-18-33-30(31)35-29(22)26)25-12-11-24(17-27(25)36-3)37-28-10-5-6-13-32-28/h4-18,34H,1-2H2,3H3,(H2,31,33,35) |
| InChIKey | AMEBEPBSLUVDJY-UHFFFAOYSA-N |
| XLogP | 6.85 |
| TPSA | 95.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.56 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|