C23H15F3N4O — CID 134265846
N-[3-[6-[5-(trifluoromethyl)-3-pyridinyl]quinazolin-8-yl]phenyl]prop-2-enamide (PubChem CID 134265846) has the molecular formula C23H15F3N4O and a molecular weight of 420.39 g/mol. Its IUPAC name is N-[3-[6-[5-(trifluoromethyl)-3-pyridinyl]quinazolin-8-yl]phenyl]prop-2-enamide.
| Compound Name | N-[3-[6-[5-(trifluoromethyl)-3-pyridinyl]quinazolin-8-yl]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 134265846 |
| Molecular Formula | C23H15F3N4O |
| Molecular Weight | 420.39 g/mol |
| Exact Mass | 420.12 |
| IUPAC Name | N-[3-[6-[5-(trifluoromethyl)-3-pyridinyl]quinazolin-8-yl]phenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1cccc(-c2cc(-c3cncc(C(F)(F)F)c3)cc3cncnc23)c1 |
| InChI | InChI=1S/C23H15F3N4O/c1-2-21(31)30-19-5-3-4-14(8-19)20-9-15(6-17-11-28-13-29-22(17)20)16-7-18(12-27-10-16)23(24,25)26/h2-13H,1H2,(H,30,31) |
| InChIKey | OUFMJTFJCZKWLA-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 67.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.39 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|