C29H20F3N5O2 — CID 134328291
N-[3-[5-amino-2-[4-[[4-(trifluoromethyl)-2-pyridinyl]oxy]phenyl]quinazolin-8-yl]phenyl]prop-2-enamide (PubChem CID 134328291) has the molecular formula C29H20F3N5O2 and a molecular weight of 527.51 g/mol. Its IUPAC name is N-[3-[5-amino-2-[4-[[4-(trifluoromethyl)-2-pyridinyl]oxy]phenyl]quinazolin-8-yl]phenyl]prop-2-enamide.
| Compound Name | N-[3-[5-amino-2-[4-[[4-(trifluoromethyl)-2-pyridinyl]oxy]phenyl]quinazolin-8-yl]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 134328291 |
| Molecular Formula | C29H20F3N5O2 |
| Molecular Weight | 527.51 g/mol |
| Exact Mass | 527.16 |
| IUPAC Name | N-[3-[5-amino-2-[4-[[4-(trifluoromethyl)-2-pyridinyl]oxy]phenyl]quinazolin-8-yl]phenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1cccc(-c2ccc(N)c3cnc(-c4ccc(Oc5cc(C(F)(F)F)ccn5)cc4)nc23)c1 |
| InChI | InChI=1S/C29H20F3N5O2/c1-2-25(38)36-20-5-3-4-18(14-20)22-10-11-24(33)23-16-35-28(37-27(22)23)17-6-8-21(9-7-17)39-26-15-19(12-13-34-26)29(30,31)32/h2-16H,1,33H2,(H,36,38) |
| InChIKey | GRPKYCLSAGANSK-UHFFFAOYSA-N |
| XLogP | 6.88 |
| TPSA | 103.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.51 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|