C26H24F3N3O — CID 142291035
methane;N-[3-[6-[(2E,4E)-5-(trifluoromethyl)hepta-2,4,6-trien-3-yl]quinazolin-8-yl]phenyl]prop-2-enamide (PubChem CID 142291035) has the molecular formula C26H24F3N3O and a molecular weight of 451.49 g/mol. Its IUPAC name is methane;N-[3-[6-[(2E,4E)-5-(trifluoromethyl)hepta-2,4,6-trien-3-yl]quinazolin-8-yl]phenyl]prop-2-enamide.
| Compound Name | methane;N-[3-[6-[(2E,4E)-5-(trifluoromethyl)hepta-2,4,6-trien-3-yl]quinazolin-8-yl]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 142291035 |
| Molecular Formula | C26H24F3N3O |
| Molecular Weight | 451.49 g/mol |
| Exact Mass | 451.19 |
| IUPAC Name | methane;N-[3-[6-[(2E,4E)-5-(trifluoromethyl)hepta-2,4,6-trien-3-yl]quinazolin-8-yl]phenyl]prop-2-enamide |
| SMILES | C.C=CC(=O)Nc1cccc(-c2cc(C(=C/C)/C=C(\C=C)C(F)(F)F)cc3cncnc23)c1 |
| InChI | InChI=1S/C25H20F3N3O.CH4/c1-4-16(11-20(5-2)25(26,27)28)18-10-19-14-29-15-30-24(19)22(13-18)17-8-7-9-21(12-17)31-23(32)6-3;/h4-15H,2-3H2,1H3,(H,31,32);1H4/b16-4+,20-11+; |
| InChIKey | NQEKFPAJYZMEAU-AVCMVBOUSA-N |
| XLogP | 7.14 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.49 |
| LogP ≤ 5 | 7.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|