C20H28F3N3O2 — CID 134265682
tert-butyl (6aR)-4-(3,3,3-trifluoropropyl)-6,6a,7,9,10,11-hexahydro-5H-[1,4]diazepino[1,2-a][1,8]naphthyridine-8-carboxylate (PubChem CID 134265682) has the molecular formula C20H28F3N3O2 and a molecular weight of 399.46 g/mol. Its IUPAC name is tert-butyl (6aR)-4-(3,3,3-trifluoropropyl)-6,6a,7,9,10,11-hexahydro-5H-[1,4]diazepino[1,2-a][1,8]naphthyridine-8-carboxylate.
| Compound Name | tert-butyl (6aR)-4-(3,3,3-trifluoropropyl)-6,6a,7,9,10,11-hexahydro-5H-[1,4]diazepino[1,2-a][1,8]naphthyridine-8-carboxylate |
|---|---|
| PubChem CID | 134265682 |
| Molecular Formula | C20H28F3N3O2 |
| Molecular Weight | 399.46 g/mol |
| Exact Mass | 399.21 |
| IUPAC Name | tert-butyl (6aR)-4-(3,3,3-trifluoropropyl)-6,6a,7,9,10,11-hexahydro-5H-[1,4]diazepino[1,2-a][1,8]naphthyridine-8-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCCN2c3nccc(CCC(F)(F)F)c3CC[C@@H]2C1 |
| InChI | InChI=1S/C20H28F3N3O2/c1-19(2,3)28-18(27)25-11-4-12-26-15(13-25)5-6-16-14(7-9-20(21,22)23)8-10-24-17(16)26/h8,10,15H,4-7,9,11-13H2,1-3H3/t15-/m1/s1 |
| InChIKey | VUUORDUPJILJBG-OAHLLOKOSA-N |
| XLogP | 4.34 |
| TPSA | 45.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.46 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |