C32H52N4O5 — CID 134266529
N-[(E)-1-[4-[4-[(7,7-dimethyl-6-oxooctyl)amino]-4-oxobutoxy]phenyl]ethylideneamino]-5-(2,2-dimethylpropanoylamino)pentanamide (PubChem CID 134266529) has the molecular formula C32H52N4O5 and a molecular weight of 572.79 g/mol. Its IUPAC name is N-[(E)-1-[4-[4-[(7,7-dimethyl-6-oxooctyl)amino]-4-oxobutoxy]phenyl]ethylideneamino]-5-(2,2-dimethylpropanoylamino)pentanamide.
| Compound Name | N-[(E)-1-[4-[4-[(7,7-dimethyl-6-oxooctyl)amino]-4-oxobutoxy]phenyl]ethylideneamino]-5-(2,2-dimethylpropanoylamino)pentanamide |
|---|---|
| PubChem CID | 134266529 |
| Molecular Formula | C32H52N4O5 |
| Molecular Weight | 572.79 g/mol |
| Exact Mass | 572.39 |
| IUPAC Name | N-[(E)-1-[4-[4-[(7,7-dimethyl-6-oxooctyl)amino]-4-oxobutoxy]phenyl]ethylideneamino]-5-(2,2-dimethylpropanoylamino)pentanamide |
| SMILES | C/C(=N\NC(=O)CCCCNC(=O)C(C)(C)C)c1ccc(OCCCC(=O)NCCCCCC(=O)C(C)(C)C)cc1 |
| InChI | InChI=1S/C32H52N4O5/c1-24(35-36-29(39)15-10-12-22-34-30(40)32(5,6)7)25-17-19-26(20-18-25)41-23-13-16-28(38)33-21-11-8-9-14-27(37)31(2,3)4/h17-20H,8-16,21-23H2,1-7H3,(H,33,38)(H,34,40)(H,36,39)/b35-24+ |
| InChIKey | AWMCWLWEWNPPRE-JWHWKPFMSA-N |
| XLogP | 5.31 |
| TPSA | 125.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.79 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|