C30H48O4S4 — CID 134272400
5-[[(2E,6E)-11-[(E)-5-[(2-sulfanylidene-1,3-oxathiolan-5-yl)methoxy]pent-3-enyl]heptadeca-2,6-dienoxy]methyl]-1,3-oxathiolane-2-thione (PubChem CID 134272400) has the molecular formula C30H48O4S4 and a molecular weight of 600.98 g/mol. Its IUPAC name is 5-[[(2E,6E)-11-[(E)-5-[(2-sulfanylidene-1,3-oxathiolan-5-yl)methoxy]pent-3-enyl]heptadeca-2,6-dienoxy]methyl]-1,3-oxathiolane-2-thione.
| Compound Name | 5-[[(2E,6E)-11-[(E)-5-[(2-sulfanylidene-1,3-oxathiolan-5-yl)methoxy]pent-3-enyl]heptadeca-2,6-dienoxy]methyl]-1,3-oxathiolane-2-thione |
|---|---|
| PubChem CID | 134272400 |
| Molecular Formula | C30H48O4S4 |
| Molecular Weight | 600.98 g/mol |
| Exact Mass | 600.24 |
| IUPAC Name | 5-[[(2E,6E)-11-[(E)-5-[(2-sulfanylidene-1,3-oxathiolan-5-yl)methoxy]pent-3-enyl]heptadeca-2,6-dienoxy]methyl]-1,3-oxathiolane-2-thione |
| SMILES | CCCCCCC(CC/C=C/COCC1CSC(=S)O1)CCC/C=C/CC/C=C/COCC1CSC(=S)O1 |
| InChI | InChI=1S/C30H48O4S4/c1-2-3-4-12-17-26(19-14-11-16-21-32-23-28-25-38-30(36)34-28)18-13-9-7-5-6-8-10-15-20-31-22-27-24-37-29(35)33-27/h5,7,10-11,15-16,26-28H,2-4,6,8-9,12-14,17-25H2,1H3/b7-5+,15-10+,16-11+ |
| InChIKey | BVJDGDHTJIRMHM-MWILOOAASA-N |
| XLogP | 8.84 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.98 |
| LogP ≤ 5 | 8.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|