C25H28BrF3N6O — CID 134276082
[1-(3-bromo-7-cyclopropylquinolin-4-yl)-3-methylpiperidin-4-yl]-[3-imino-4-(2,2,2-trifluoroethanimidoyl)piperazin-1-yl]methanone (PubChem CID 134276082) has the molecular formula C25H28BrF3N6O and a molecular weight of 565.44 g/mol. Its IUPAC name is [1-(3-bromo-7-cyclopropylquinolin-4-yl)-3-methylpiperidin-4-yl]-[3-imino-4-(2,2,2-trifluoroethanimidoyl)piperazin-1-yl]methanone.
| Compound Name | [1-(3-bromo-7-cyclopropylquinolin-4-yl)-3-methylpiperidin-4-yl]-[3-imino-4-(2,2,2-trifluoroethanimidoyl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 134276082 |
| Molecular Formula | C25H28BrF3N6O |
| Molecular Weight | 565.44 g/mol |
| Exact Mass | 564.15 |
| IUPAC Name | [1-(3-bromo-7-cyclopropylquinolin-4-yl)-3-methylpiperidin-4-yl]-[3-imino-4-(2,2,2-trifluoroethanimidoyl)piperazin-1-yl]methanone |
| SMILES | [H]/N=C1\CN(C(=O)C2CCN(c3c(Br)cnc4cc(C5CC5)ccc34)CC2C)CCN1/C(=N/[H])C(F)(F)F |
| InChI | InChI=1S/C25H28BrF3N6O/c1-14-12-33(22-18-5-4-16(15-2-3-15)10-20(18)32-11-19(22)26)7-6-17(14)23(36)34-8-9-35(21(30)13-34)24(31)25(27,28)29/h4-5,10-11,14-15,17,30-31H,2-3,6-9,12-13H2,1H3/b30-21+,31-24+ |
| InChIKey | DNQKUVLQPFRHTJ-UXARKOHBSA-N |
| XLogP | 5.00 |
| TPSA | 87.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.44 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|