C23H26ClF3N6O — CID 166813270
[1-(6-chloro-2-methylquinolin-4-yl)-3-methylpiperidin-4-yl]-[3-imino-4-(2,2,2-trifluoroethanimidoyl)piperazin-1-yl]methanone (PubChem CID 166813270) has the molecular formula C23H26ClF3N6O and a molecular weight of 494.95 g/mol. Its IUPAC name is [1-(6-chloro-2-methylquinolin-4-yl)-3-methylpiperidin-4-yl]-[3-imino-4-(2,2,2-trifluoroethanimidoyl)piperazin-1-yl]methanone.
| Compound Name | [1-(6-chloro-2-methylquinolin-4-yl)-3-methylpiperidin-4-yl]-[3-imino-4-(2,2,2-trifluoroethanimidoyl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 166813270 |
| Molecular Formula | C23H26ClF3N6O |
| Molecular Weight | 494.95 g/mol |
| Exact Mass | 494.18 |
| IUPAC Name | [1-(6-chloro-2-methylquinolin-4-yl)-3-methylpiperidin-4-yl]-[3-imino-4-(2,2,2-trifluoroethanimidoyl)piperazin-1-yl]methanone |
| SMILES | [H]/N=C1\CN(C(=O)C2CCN(c3cc(C)nc4ccc(Cl)cc34)CC2C)CCN1/C(=N/[H])C(F)(F)F |
| InChI | InChI=1S/C23H26ClF3N6O/c1-13-11-31(19-9-14(2)30-18-4-3-15(24)10-17(18)19)6-5-16(13)21(34)32-7-8-33(20(28)12-32)22(29)23(25,26)27/h3-4,9-10,13,16,28-29H,5-8,11-12H2,1-2H3/b28-20+,29-22+ |
| InChIKey | VSHCWPIPYUZFAW-LSVVSADDSA-N |
| XLogP | 4.32 |
| TPSA | 87.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.95 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|