C21H26N4O6 — CID 134278891
5-[4-(3,4-dimethoxybenzoyl)-7-oxo-5,6-dihydropyrazolo[4,5-b]pyridin-1-yl]pentylcarbamic acid (PubChem CID 134278891) has the molecular formula C21H26N4O6 and a molecular weight of 430.46 g/mol. Its IUPAC name is 5-[4-(3,4-dimethoxybenzoyl)-7-oxo-5,6-dihydropyrazolo[4,5-b]pyridin-1-yl]pentylcarbamic acid.
| Compound Name | 5-[4-(3,4-dimethoxybenzoyl)-7-oxo-5,6-dihydropyrazolo[4,5-b]pyridin-1-yl]pentylcarbamic acid |
|---|---|
| PubChem CID | 134278891 |
| Molecular Formula | C21H26N4O6 |
| Molecular Weight | 430.46 g/mol |
| Exact Mass | 430.19 |
| IUPAC Name | 5-[4-(3,4-dimethoxybenzoyl)-7-oxo-5,6-dihydropyrazolo[4,5-b]pyridin-1-yl]pentylcarbamic acid |
| SMILES | COc1ccc(C(=O)N2CCC(=O)c3c2cnn3CCCCCNC(=O)O)cc1OC |
| InChI | InChI=1S/C21H26N4O6/c1-30-17-7-6-14(12-18(17)31-2)20(27)24-11-8-16(26)19-15(24)13-23-25(19)10-5-3-4-9-22-21(28)29/h6-7,12-13,22H,3-5,8-11H2,1-2H3,(H,28,29) |
| InChIKey | SNLQXJPLTGQVOH-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 122.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.46 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|