C17H29NO3 — CID 134284799
(2E)-2-(2-oxoundecylidene)-5-propan-2-yl-1,3-oxazolidin-4-one (PubChem CID 134284799) has the molecular formula C17H29NO3 and a molecular weight of 295.42 g/mol. Its IUPAC name is (2E)-2-(2-oxoundecylidene)-5-propan-2-yl-1,3-oxazolidin-4-one.
| Compound Name | (2E)-2-(2-oxoundecylidene)-5-propan-2-yl-1,3-oxazolidin-4-one |
|---|---|
| PubChem CID | 134284799 |
| Molecular Formula | C17H29NO3 |
| Molecular Weight | 295.42 g/mol |
| Exact Mass | 295.21 |
| IUPAC Name | (2E)-2-(2-oxoundecylidene)-5-propan-2-yl-1,3-oxazolidin-4-one |
| SMILES | CCCCCCCCCC(=O)/C=C1\NC(=O)C(C(C)C)O1 |
| InChI | InChI=1S/C17H29NO3/c1-4-5-6-7-8-9-10-11-14(19)12-15-18-17(20)16(21-15)13(2)3/h12-13,16H,4-11H2,1-3H3,(H,18,20)/b15-12+ |
| InChIKey | FVQKAGAGEXLLSE-NTCAYCPXSA-N |
| XLogP | 3.71 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.42 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|