C19H33NO2 — CID 134302310
(1E)-1-[(5S)-5-butyl-4-methylidene-1,3-oxazolidin-2-ylidene]undecan-2-one (PubChem CID 134302310) has the molecular formula C19H33NO2 and a molecular weight of 307.48 g/mol. Its IUPAC name is (1E)-1-[(5S)-5-butyl-4-methylidene-1,3-oxazolidin-2-ylidene]undecan-2-one.
| Compound Name | (1E)-1-[(5S)-5-butyl-4-methylidene-1,3-oxazolidin-2-ylidene]undecan-2-one |
|---|---|
| PubChem CID | 134302310 |
| Molecular Formula | C19H33NO2 |
| Molecular Weight | 307.48 g/mol |
| Exact Mass | 307.25 |
| IUPAC Name | (1E)-1-[(5S)-5-butyl-4-methylidene-1,3-oxazolidin-2-ylidene]undecan-2-one |
| SMILES | C=C1N/C(=C\C(=O)CCCCCCCCC)O[C@H]1CCCC |
| InChI | InChI=1S/C19H33NO2/c1-4-6-8-9-10-11-12-13-17(21)15-19-20-16(3)18(22-19)14-7-5-2/h15,18,20H,3-14H2,1-2H3/b19-15+/t18-/m0/s1 |
| InChIKey | ZJLCKPOLLZWFNF-CMAIMYMYSA-N |
| XLogP | 5.23 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.48 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|