C12H21NO2 — CID 121001587
(1Z)-1-(4,4,6-trimethyl-1,3-oxazinan-2-ylidene)pentan-2-one (PubChem CID 121001587) has the molecular formula C12H21NO2 and a molecular weight of 211.30 g/mol. Its IUPAC name is (1Z)-1-(4,4,6-trimethyl-1,3-oxazinan-2-ylidene)pentan-2-one.
| Compound Name | (1Z)-1-(4,4,6-trimethyl-1,3-oxazinan-2-ylidene)pentan-2-one |
|---|---|
| PubChem CID | 121001587 |
| Molecular Formula | C12H21NO2 |
| Molecular Weight | 211.30 g/mol |
| Exact Mass | 211.16 |
| IUPAC Name | (1Z)-1-(4,4,6-trimethyl-1,3-oxazinan-2-ylidene)pentan-2-one |
| SMILES | CCCC(=O)/C=C1/NC(C)(C)CC(C)O1 |
| InChI | InChI=1S/C12H21NO2/c1-5-6-10(14)7-11-13-12(3,4)8-9(2)15-11/h7,9,13H,5-6,8H2,1-4H3/b11-7- |
| InChIKey | WMXFYTLYMYVKHA-XFFZJAGNSA-N |
| XLogP | 2.37 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.30 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|