C14H24O5S2 — CID 134285786
2-(6-hydroxy-3,7-dimethylbicyclo[3.3.1]nonane-3-carbonyl)sulfanylethanesulfonic acid (PubChem CID 134285786) has the molecular formula C14H24O5S2 and a molecular weight of 336.48 g/mol. Its IUPAC name is 2-(6-hydroxy-3,7-dimethylbicyclo[3.3.1]nonane-3-carbonyl)sulfanylethanesulfonic acid.
| Compound Name | 2-(6-hydroxy-3,7-dimethylbicyclo[3.3.1]nonane-3-carbonyl)sulfanylethanesulfonic acid |
|---|---|
| PubChem CID | 134285786 |
| Molecular Formula | C14H24O5S2 |
| Molecular Weight | 336.48 g/mol |
| Exact Mass | 336.11 |
| IUPAC Name | 2-(6-hydroxy-3,7-dimethylbicyclo[3.3.1]nonane-3-carbonyl)sulfanylethanesulfonic acid |
| SMILES | CC1CC2CC(CC(C)(C(=O)SCCS(=O)(=O)O)C2)C1O |
| InChI | InChI=1S/C14H24O5S2/c1-9-5-10-6-11(12(9)15)8-14(2,7-10)13(16)20-3-4-21(17,18)19/h9-12,15H,3-8H2,1-2H3,(H,17,18,19) |
| InChIKey | XJPONOBDNWPOFP-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 91.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.48 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|