About 2-(6-hydroxy-3,7-dimethylbicyclo[3.3.1]nonane-3-carbonyl)sulfanylethanesulfonic acid
2-(6-hydroxy-3,7-dimethylbicyclo[3.3.1]nonane-3-carbonyl)sulfanylethanesulfonic acid (PubChem CID 134285786) has the molecular formula C14H24O5S2
and a molecular weight of 336.48 g/mol. Its IUPAC name is 2-(6-hydroxy-3,7-dimethylbicyclo[3.3.1]nonane-3-carbonyl)sulfanylethanesulfonic acid.
Molecular Properties
| Compound Name | 2-(6-hydroxy-3,7-dimethylbicyclo[3.3.1]nonane-3-carbonyl)sulfanylethanesulfonic acid |
| PubChem CID | 134285786 |
| Molecular Formula | C14H24O5S2 |
| Molecular Weight | 336.48 g/mol |
| Exact Mass | 336.11 |
| IUPAC Name | 2-(6-hydroxy-3,7-dimethylbicyclo[3.3.1]nonane-3-carbonyl)sulfanylethanesulfonic acid |
| SMILES | CC1CC2CC(CC(C)(C(=O)SCCS(=O)(=O)O)C2)C1O |
| InChI | InChI=1S/C14H24O5S2/c1-9-5-10-6-11(12(9)15)8-14(2,7-10)13(16)20-3-4-21(17,18)19/h9-12,15H,3-8H2,1-2H3,(H,17,18,19) |
| InChIKey | XJPONOBDNWPOFP-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 91.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 336.48 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze 2-(6-hydroxy-3,7-dimethylbicyclo[3.3.1]nonane-3-carbonyl)sulfanylethanesulfonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(6-hydroxy-3,7-dimethylbicyclo[3.3.1]nonane-3-carbonyl)sulfanylethanesulfonic acid?
The IUPAC name of 2-(6-hydroxy-3,7-dimethylbicyclo[3.3.1]nonane-3-carbonyl)sulfanylethanesulfonic acid (CID 134285786) is 2-(6-hydroxy-3,7-dimethylbicyclo[3.3.1]nonane-3-carbonyl)sulfanylethanesulfonic acid.
What is the SMILES notation for 2-(6-hydroxy-3,7-dimethylbicyclo[3.3.1]nonane-3-carbonyl)sulfanylethanesulfonic acid?
The canonical SMILES for 2-(6-hydroxy-3,7-dimethylbicyclo[3.3.1]nonane-3-carbonyl)sulfanylethanesulfonic acid is CC1CC2CC(CC(C)(C(=O)SCCS(=O)(=O)O)C2)C1O.
What is the InChIKey of 2-(6-hydroxy-3,7-dimethylbicyclo[3.3.1]nonane-3-carbonyl)sulfanylethanesulfonic acid?
The InChIKey is XJPONOBDNWPOFP-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H24O5S2/c1-9-5-10-6-11(12(9)15)8-14(2,7-10)13(16)20-3-4-21(17,18)19/h9-12,15H,3-8H2,1-2H3,(H,17,18,19).
What are the key properties of 2-(6-hydroxy-3,7-dimethylbicyclo[3.3.1]nonane-3-carbonyl)sulfanylethanesulfonic acid?
2-(6-hydroxy-3,7-dimethylbicyclo[3.3.1]nonane-3-carbonyl)sulfanylethanesulfonic acid has a molecular weight of 336.48 g/mol, XLogP of 1.96, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(6-hydroxy-3,7-dimethylbicyclo[3.3.1]nonane-3-carbonyl)sulfanylethanesulfonic acid is sourced from PubChem (CID 134285786), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).