C16H24ClNO — CID 134288514
1-[(5Z,7Z)-8-chloro-7-ethenoxy-4-methylidenenona-5,7-dienyl]pyrrolidine (PubChem CID 134288514) has the molecular formula C16H24ClNO and a molecular weight of 281.83 g/mol. Its IUPAC name is 1-[(5Z,7Z)-8-chloro-7-ethenoxy-4-methylidenenona-5,7-dienyl]pyrrolidine.
| Compound Name | 1-[(5Z,7Z)-8-chloro-7-ethenoxy-4-methylidenenona-5,7-dienyl]pyrrolidine |
|---|---|
| PubChem CID | 134288514 |
| Molecular Formula | C16H24ClNO |
| Molecular Weight | 281.83 g/mol |
| Exact Mass | 281.15 |
| IUPAC Name | 1-[(5Z,7Z)-8-chloro-7-ethenoxy-4-methylidenenona-5,7-dienyl]pyrrolidine |
| SMILES | C=COC(/C=C\C(=C)CCCN1CCCC1)=C(/C)Cl |
| InChI | InChI=1S/C16H24ClNO/c1-4-19-16(15(3)17)10-9-14(2)8-7-13-18-11-5-6-12-18/h4,9-10H,1-2,5-8,11-13H2,3H3/b10-9-,16-15- |
| InChIKey | RWBSEGYKJOIRAG-GJWNNSPJSA-N |
| XLogP | 4.61 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.83 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|