C10H10O3 — CID 134291801
4-hydroxy-6-methyl-4a,8a-dihydrochromen-2-one (PubChem CID 134291801) has the molecular formula C10H10O3 and a molecular weight of 178.19 g/mol. Its IUPAC name is 4-hydroxy-6-methyl-4a,8a-dihydrochromen-2-one.
| Compound Name | 4-hydroxy-6-methyl-4a,8a-dihydrochromen-2-one |
|---|---|
| PubChem CID | 134291801 |
| Molecular Formula | C10H10O3 |
| Molecular Weight | 178.19 g/mol |
| Exact Mass | 178.06 |
| IUPAC Name | 4-hydroxy-6-methyl-4a,8a-dihydrochromen-2-one |
| SMILES | CC1=CC2C(O)=CC(=O)OC2C=C1 |
| InChI | InChI=1S/C10H10O3/c1-6-2-3-9-7(4-6)8(11)5-10(12)13-9/h2-5,7,9,11H,1H3 |
| InChIKey | HTCYBMXAKSKWNN-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.19 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |