C10H12O3 — CID 53433846
7-methyl-5a,9a-dihydro-1,5-benzodioxepin-3-one (PubChem CID 53433846) has the molecular formula C10H12O3 and a molecular weight of 180.20 g/mol. Its IUPAC name is 7-methyl-5a,9a-dihydro-1,5-benzodioxepin-3-one.
| Compound Name | 7-methyl-5a,9a-dihydro-1,5-benzodioxepin-3-one |
|---|---|
| PubChem CID | 53433846 |
| Molecular Formula | C10H12O3 |
| Molecular Weight | 180.20 g/mol |
| Exact Mass | 180.08 |
| IUPAC Name | 7-methyl-5a,9a-dihydro-1,5-benzodioxepin-3-one |
| SMILES | CC1=CC2OCC(=O)COC2C=C1 |
| InChI | InChI=1S/C10H12O3/c1-7-2-3-9-10(4-7)13-6-8(11)5-12-9/h2-4,9-10H,5-6H2,1H3 |
| InChIKey | ZFTLPTYXQVNGCV-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.20 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |