C11H15ClO2 — CID 153286296
7-(1-chloroethyl)-3,4,5a,9a-tetrahydro-2H-1,5-benzodioxepine (PubChem CID 153286296) has the molecular formula C11H15ClO2 and a molecular weight of 214.69 g/mol. Its IUPAC name is 7-(1-chloroethyl)-3,4,5a,9a-tetrahydro-2H-1,5-benzodioxepine.
| Compound Name | 7-(1-chloroethyl)-3,4,5a,9a-tetrahydro-2H-1,5-benzodioxepine |
|---|---|
| PubChem CID | 153286296 |
| Molecular Formula | C11H15ClO2 |
| Molecular Weight | 214.69 g/mol |
| Exact Mass | 214.08 |
| IUPAC Name | 7-(1-chloroethyl)-3,4,5a,9a-tetrahydro-2H-1,5-benzodioxepine |
| SMILES | CC(Cl)C1=CC2OCCCOC2C=C1 |
| InChI | InChI=1S/C11H15ClO2/c1-8(12)9-3-4-10-11(7-9)14-6-2-5-13-10/h3-4,7-8,10-11H,2,5-6H2,1H3 |
| InChIKey | JIVKKPDJMLEUCV-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.69 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|