C21H14FN5O — CID 134298590
1-(4-cyanophenyl)-3-[6-(4-fluorophenyl)imidazo[1,5-a]pyridin-5-yl]urea (PubChem CID 134298590) has the molecular formula C21H14FN5O and a molecular weight of 371.38 g/mol. Its IUPAC name is 1-(4-cyanophenyl)-3-[6-(4-fluorophenyl)imidazo[1,5-a]pyridin-5-yl]urea.
| Compound Name | 1-(4-cyanophenyl)-3-[6-(4-fluorophenyl)imidazo[1,5-a]pyridin-5-yl]urea |
|---|---|
| PubChem CID | 134298590 |
| Molecular Formula | C21H14FN5O |
| Molecular Weight | 371.38 g/mol |
| Exact Mass | 371.12 |
| IUPAC Name | 1-(4-cyanophenyl)-3-[6-(4-fluorophenyl)imidazo[1,5-a]pyridin-5-yl]urea |
| SMILES | N#Cc1ccc(NC(=O)Nc2c(-c3ccc(F)cc3)ccc3cncn23)cc1 |
| InChI | InChI=1S/C21H14FN5O/c22-16-5-3-15(4-6-16)19-10-9-18-12-24-13-27(18)20(19)26-21(28)25-17-7-1-14(11-23)2-8-17/h1-10,12-13H,(H2,25,26,28) |
| InChIKey | VFHSSKXLYIAXSU-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 82.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.38 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |