C13H16N4O5S2 — CID 134310335
2-[(2S,4S,5R)-5-(5-amino-7-methyl-2-oxo-[1,3]thiazolo[4,5-d]pyrimidin-3-yl)-2-[(1S)-1-hydroxyethyl]-1,3-oxathiolan-4-yl]acetic acid (PubChem CID 134310335) has the molecular formula C13H16N4O5S2 and a molecular weight of 372.43 g/mol. Its IUPAC name is 2-[(2S,4S,5R)-5-(5-amino-7-methyl-2-oxo-[1,3]thiazolo[4,5-d]pyrimidin-3-yl)-2-[(1S)-1-hydroxyethyl]-1,3-oxathiolan-4-yl]acetic acid.
| Compound Name | 2-[(2S,4S,5R)-5-(5-amino-7-methyl-2-oxo-[1,3]thiazolo[4,5-d]pyrimidin-3-yl)-2-[(1S)-1-hydroxyethyl]-1,3-oxathiolan-4-yl]acetic acid |
|---|---|
| PubChem CID | 134310335 |
| Molecular Formula | C13H16N4O5S2 |
| Molecular Weight | 372.43 g/mol |
| Exact Mass | 372.06 |
| IUPAC Name | 2-[(2S,4S,5R)-5-(5-amino-7-methyl-2-oxo-[1,3]thiazolo[4,5-d]pyrimidin-3-yl)-2-[(1S)-1-hydroxyethyl]-1,3-oxathiolan-4-yl]acetic acid |
| SMILES | Cc1nc(N)nc2c1sc(=O)n2[C@@H]1O[C@H]([C@H](C)O)S[C@H]1CC(=O)O |
| InChI | InChI=1S/C13H16N4O5S2/c1-4-8-9(16-12(14)15-4)17(13(21)24-8)10-6(3-7(19)20)23-11(22-10)5(2)18/h5-6,10-11,18H,3H2,1-2H3,(H,19,20)(H2,14,15,16)/t5-,6-,10+,11-/m0/s1 |
| InChIKey | BMMJUNIYNBURQK-PZSGYLRBSA-N |
| XLogP | 0.56 |
| TPSA | 140.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.43 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |