C19H39NO3 — CID 134314155
(2-amino-8-hydroxy-2,5,5,6,6,9,9-heptamethyldecan-4-yl) acetate (PubChem CID 134314155) has the molecular formula C19H39NO3 and a molecular weight of 329.53 g/mol. Its IUPAC name is (2-amino-8-hydroxy-2,5,5,6,6,9,9-heptamethyldecan-4-yl) acetate.
| Compound Name | (2-amino-8-hydroxy-2,5,5,6,6,9,9-heptamethyldecan-4-yl) acetate |
|---|---|
| PubChem CID | 134314155 |
| Molecular Formula | C19H39NO3 |
| Molecular Weight | 329.53 g/mol |
| Exact Mass | 329.29 |
| IUPAC Name | (2-amino-8-hydroxy-2,5,5,6,6,9,9-heptamethyldecan-4-yl) acetate |
| SMILES | CC(=O)OC(CC(C)(C)N)C(C)(C)C(C)(C)CC(O)C(C)(C)C |
| InChI | InChI=1S/C19H39NO3/c1-13(21)23-15(12-18(7,8)20)19(9,10)17(5,6)11-14(22)16(2,3)4/h14-15,22H,11-12,20H2,1-10H3 |
| InChIKey | MHCFQJRTIPCUHZ-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.53 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |