C35H66O7 — CID 138526306
[3-[8-acetyloxy-2-(2-hydroxy-3,3-dimethylbutyl)-2,3,3,6,6,7,7,10,10-nonamethylundecan-4-yl]oxy-2-hydroxypropyl] 2-methylprop-2-enoate (PubChem CID 138526306) has the molecular formula C35H66O7 and a molecular weight of 598.91 g/mol. Its IUPAC name is [3-[8-acetyloxy-2-(2-hydroxy-3,3-dimethylbutyl)-2,3,3,6,6,7,7,10,10-nonamethylundecan-4-yl]oxy-2-hydroxypropyl] 2-methylprop-2-enoate.
| Compound Name | [3-[8-acetyloxy-2-(2-hydroxy-3,3-dimethylbutyl)-2,3,3,6,6,7,7,10,10-nonamethylundecan-4-yl]oxy-2-hydroxypropyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 138526306 |
| Molecular Formula | C35H66O7 |
| Molecular Weight | 598.91 g/mol |
| Exact Mass | 598.48 |
| IUPAC Name | [3-[8-acetyloxy-2-(2-hydroxy-3,3-dimethylbutyl)-2,3,3,6,6,7,7,10,10-nonamethylundecan-4-yl]oxy-2-hydroxypropyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCC(O)COC(CC(C)(C)C(C)(C)C(CC(C)(C)C)OC(C)=O)C(C)(C)C(C)(C)CC(O)C(C)(C)C |
| InChI | InChI=1S/C35H66O7/c1-23(2)29(39)41-22-25(37)21-40-27(34(14,15)32(10,11)18-26(38)31(7,8)9)20-33(12,13)35(16,17)28(42-24(3)36)19-30(4,5)6/h25-28,37-38H,1,18-22H2,2-17H3 |
| InChIKey | VWAMGSMKEIFMID-UHFFFAOYSA-N |
| XLogP | 7.51 |
| TPSA | 102.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.91 |
| LogP ≤ 5 | 7.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|