C32H61NO4 — CID 143884933
[(8S)-2-(2-hydroxy-3,3-dimethylbutyl)-2,3,3,6,6,7,7,10,10-nonamethyl-8-(2-oxopyrrolidin-1-yl)undecan-4-yl] acetate (PubChem CID 143884933) has the molecular formula C32H61NO4 and a molecular weight of 523.84 g/mol. Its IUPAC name is [(8S)-2-(2-hydroxy-3,3-dimethylbutyl)-2,3,3,6,6,7,7,10,10-nonamethyl-8-(2-oxopyrrolidin-1-yl)undecan-4-yl] acetate.
| Compound Name | [(8S)-2-(2-hydroxy-3,3-dimethylbutyl)-2,3,3,6,6,7,7,10,10-nonamethyl-8-(2-oxopyrrolidin-1-yl)undecan-4-yl] acetate |
|---|---|
| PubChem CID | 143884933 |
| Molecular Formula | C32H61NO4 |
| Molecular Weight | 523.84 g/mol |
| Exact Mass | 523.46 |
| IUPAC Name | [(8S)-2-(2-hydroxy-3,3-dimethylbutyl)-2,3,3,6,6,7,7,10,10-nonamethyl-8-(2-oxopyrrolidin-1-yl)undecan-4-yl] acetate |
| SMILES | CC(=O)OC(CC(C)(C)C(C)(C)[C@H](CC(C)(C)C)N1CCCC1=O)C(C)(C)C(C)(C)CC(O)C(C)(C)C |
| InChI | InChI=1S/C32H61NO4/c1-22(34)37-25(32(14,15)29(8,9)20-24(35)28(5,6)7)21-30(10,11)31(12,13)23(19-27(2,3)4)33-18-16-17-26(33)36/h23-25,35H,16-21H2,1-15H3/t23-,24?,25?/m0/s1 |
| InChIKey | JCHWPWQKJDAZHP-KAVZGVEFSA-N |
| XLogP | 7.64 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.84 |
| LogP ≤ 5 | 7.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |