C33H62O7 — CID 123702546
[3-(9-acetyloxy-6-hydroxy-2,2,4,4,5,5,7,7,8,8,11,11-dodecamethyldodecan-3-yl)oxy-2-hydroxypropyl] 2-methylprop-2-enoate (PubChem CID 123702546) has the molecular formula C33H62O7 and a molecular weight of 570.85 g/mol. Its IUPAC name is [3-(9-acetyloxy-6-hydroxy-2,2,4,4,5,5,7,7,8,8,11,11-dodecamethyldodecan-3-yl)oxy-2-hydroxypropyl] 2-methylprop-2-enoate.
| Compound Name | [3-(9-acetyloxy-6-hydroxy-2,2,4,4,5,5,7,7,8,8,11,11-dodecamethyldodecan-3-yl)oxy-2-hydroxypropyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 123702546 |
| Molecular Formula | C33H62O7 |
| Molecular Weight | 570.85 g/mol |
| Exact Mass | 570.45 |
| IUPAC Name | [3-(9-acetyloxy-6-hydroxy-2,2,4,4,5,5,7,7,8,8,11,11-dodecamethyldodecan-3-yl)oxy-2-hydroxypropyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCC(O)COC(C(C)(C)C)C(C)(C)C(C)(C)C(O)C(C)(C)C(C)(C)C(CC(C)(C)C)OC(C)=O |
| InChI | InChI=1S/C33H62O7/c1-21(2)25(36)38-19-23(35)20-39-27(29(7,8)9)33(16,17)32(14,15)26(37)31(12,13)30(10,11)24(40-22(3)34)18-28(4,5)6/h23-24,26-27,35,37H,1,18-20H2,2-17H3 |
| InChIKey | UOGURJXHGRWOEB-UHFFFAOYSA-N |
| XLogP | 6.73 |
| TPSA | 102.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.85 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|