C29H30FN3O8S — CID 134318267
[(3R)-14-(8-fluoro-1,2,6,11-tetrahydrobenzo[c][1]benzothiepin-10-yl)-9,12-dioxo-5-oxa-1,2,8-triazatricyclo[8.4.0.03,8]tetradeca-10,13-dien-11-yl]oxymethyl 2-methoxyethyl carbonate (PubChem CID 134318267) has the molecular formula C29H30FN3O8S and a molecular weight of 599.64 g/mol. Its IUPAC name is [(3R)-14-(8-fluoro-1,2,6,11-tetrahydrobenzo[c][1]benzothiepin-10-yl)-9,12-dioxo-5-oxa-1,2,8-triazatricyclo[8.4.0.03,8]tetradeca-10,13-dien-11-yl]oxymethyl 2-methoxyethyl carbonate.
| Compound Name | [(3R)-14-(8-fluoro-1,2,6,11-tetrahydrobenzo[c][1]benzothiepin-10-yl)-9,12-dioxo-5-oxa-1,2,8-triazatricyclo[8.4.0.03,8]tetradeca-10,13-dien-11-yl]oxymethyl 2-methoxyethyl carbonate |
|---|---|
| PubChem CID | 134318267 |
| Molecular Formula | C29H30FN3O8S |
| Molecular Weight | 599.64 g/mol |
| Exact Mass | 599.17 |
| IUPAC Name | [(3R)-14-(8-fluoro-1,2,6,11-tetrahydrobenzo[c][1]benzothiepin-10-yl)-9,12-dioxo-5-oxa-1,2,8-triazatricyclo[8.4.0.03,8]tetradeca-10,13-dien-11-yl]oxymethyl 2-methoxyethyl carbonate |
| SMILES | COCCOC(=O)OCOc1c2n(c(-c3cc(F)cc4c3CC3=C(C=CCC3)SC4)cc1=O)N[C@@H]1COCCN1C2=O |
| InChI | InChI=1S/C29H30FN3O8S/c1-37-8-9-39-29(36)41-16-40-27-23(34)13-22(33-26(27)28(35)32-6-7-38-14-25(32)31-33)21-12-19(30)10-18-15-42-24-5-3-2-4-17(24)11-20(18)21/h3,5,10,12-13,25,31H,2,4,6-9,11,14-16H2,1H3/t25-/m0/s1 |
| InChIKey | PXCDJDOTKOMFSQ-VWLOTQADSA-N |
| XLogP | 3.54 |
| TPSA | 117.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.64 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|