C30H51N3O2S — CID 134319868
N-[(5S)-6-amino-6-oxo-5-(sulfanylamino)hexyl]-17-butan-2-yl-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-3-carboxamide (PubChem CID 134319868) has the molecular formula C30H51N3O2S and a molecular weight of 517.82 g/mol. Its IUPAC name is N-[(5S)-6-amino-6-oxo-5-(sulfanylamino)hexyl]-17-butan-2-yl-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-3-carboxamide.
| Compound Name | N-[(5S)-6-amino-6-oxo-5-(sulfanylamino)hexyl]-17-butan-2-yl-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-3-carboxamide |
|---|---|
| PubChem CID | 134319868 |
| Molecular Formula | C30H51N3O2S |
| Molecular Weight | 517.82 g/mol |
| Exact Mass | 517.37 |
| IUPAC Name | N-[(5S)-6-amino-6-oxo-5-(sulfanylamino)hexyl]-17-butan-2-yl-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-3-carboxamide |
| SMILES | CCC(C)C1CCC2C3CC=C4CC(C(=O)NCCCC[C@H](NS)C(N)=O)CCC4(C)C3CCC12C |
| InChI | InChI=1S/C30H51N3O2S/c1-5-19(2)23-11-12-24-22-10-9-21-18-20(13-15-29(21,3)25(22)14-16-30(23,24)4)28(35)32-17-7-6-8-26(33-36)27(31)34/h9,19-20,22-26,33,36H,5-8,10-18H2,1-4H3,(H2,31,34)(H,32,35)/t19?,20?,22?,23?,24?,25?,26-,29?,30?/m0/s1 |
| InChIKey | DEPCHYIIRZUYNX-DKWRUGQBSA-N |
| XLogP | 5.80 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.82 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|