C32H28N6O3 — CID 134320230
6-[[(E)-1-[(1-formyl-3,4-diphenylpyrazol-5-yl)amino]-2-(4-methoxyphenyl)prop-1-enyl]amino]pyridine-2-carboxamide (PubChem CID 134320230) has the molecular formula C32H28N6O3 and a molecular weight of 544.62 g/mol. Its IUPAC name is 6-[[(E)-1-[(1-formyl-3,4-diphenylpyrazol-5-yl)amino]-2-(4-methoxyphenyl)prop-1-enyl]amino]pyridine-2-carboxamide.
| Compound Name | 6-[[(E)-1-[(1-formyl-3,4-diphenylpyrazol-5-yl)amino]-2-(4-methoxyphenyl)prop-1-enyl]amino]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 134320230 |
| Molecular Formula | C32H28N6O3 |
| Molecular Weight | 544.62 g/mol |
| Exact Mass | 544.22 |
| IUPAC Name | 6-[[(E)-1-[(1-formyl-3,4-diphenylpyrazol-5-yl)amino]-2-(4-methoxyphenyl)prop-1-enyl]amino]pyridine-2-carboxamide |
| SMILES | COc1ccc(/C(C)=C(\Nc2cccc(C(N)=O)n2)Nc2c(-c3ccccc3)c(-c3ccccc3)nn2C=O)cc1 |
| InChI | InChI=1S/C32H28N6O3/c1-21(22-16-18-25(41-2)19-17-22)31(35-27-15-9-14-26(34-27)30(33)40)36-32-28(23-10-5-3-6-11-23)29(37-38(32)20-39)24-12-7-4-8-13-24/h3-20,36H,1-2H3,(H2,33,40)(H,34,35)/b31-21+ |
| InChIKey | YANZDNFGKNYBOB-NJZRLIGZSA-N |
| XLogP | 5.67 |
| TPSA | 124.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.62 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|