C15H29NO — CID 134332421
3-amino-5,7-dimethyl-9-methylidenedodecanal (PubChem CID 134332421) has the molecular formula C15H29NO and a molecular weight of 239.40 g/mol. Its IUPAC name is 3-amino-5,7-dimethyl-9-methylidenedodecanal.
| Compound Name | 3-amino-5,7-dimethyl-9-methylidenedodecanal |
|---|---|
| PubChem CID | 134332421 |
| Molecular Formula | C15H29NO |
| Molecular Weight | 239.40 g/mol |
| Exact Mass | 239.22 |
| IUPAC Name | 3-amino-5,7-dimethyl-9-methylidenedodecanal |
| SMILES | C=C(CCC)CC(C)CC(C)CC(N)CC=O |
| InChI | InChI=1S/C15H29NO/c1-5-6-12(2)9-13(3)10-14(4)11-15(16)7-8-17/h8,13-15H,2,5-7,9-11,16H2,1,3-4H3 |
| InChIKey | UKMIZPFGSXJTRA-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.40 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|