About 3-amino-4,5-dioxoicosanal
3-amino-4,5-dioxoicosanal (PubChem CID 56976787) has the molecular formula C20H37NO3
and a molecular weight of 339.52 g/mol. Its IUPAC name is 3-amino-4,5-dioxoicosanal.
Molecular Properties
| Compound Name | 3-amino-4,5-dioxoicosanal |
| PubChem CID | 56976787 |
| Molecular Formula | C20H37NO3 |
| Molecular Weight | 339.52 g/mol |
| Exact Mass | 339.28 |
| IUPAC Name | 3-amino-4,5-dioxoicosanal |
| SMILES | CCCCCCCCCCCCCCCC(=O)C(=O)C(N)CC=O |
| InChI | InChI=1S/C20H37NO3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-19(23)20(24)18(21)16-17-22/h17-18H,2-16,21H2,1H3 |
| InChIKey | ZNNXTPQPNRWZPR-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 77.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 339.52 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze 3-amino-4,5-dioxoicosanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-4,5-dioxoicosanal?
The IUPAC name of 3-amino-4,5-dioxoicosanal (CID 56976787) is 3-amino-4,5-dioxoicosanal.
What is the SMILES notation for 3-amino-4,5-dioxoicosanal?
The canonical SMILES for 3-amino-4,5-dioxoicosanal is CCCCCCCCCCCCCCCC(=O)C(=O)C(N)CC=O.
What is the InChIKey of 3-amino-4,5-dioxoicosanal?
The InChIKey is ZNNXTPQPNRWZPR-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H37NO3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-19(23)20(24)18(21)16-17-22/h17-18H,2-16,21H2,1H3.
What are the key properties of 3-amino-4,5-dioxoicosanal?
3-amino-4,5-dioxoicosanal has a molecular weight of 339.52 g/mol, XLogP of 4.52, 18 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-4,5-dioxoicosanal is sourced from PubChem (CID 56976787), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).