C16H22F2 — CID 134342243
1-but-3-enyl-4-(5,5-difluorohexan-2-yl)benzene (PubChem CID 134342243) has the molecular formula C16H22F2 and a molecular weight of 252.35 g/mol. Its IUPAC name is 1-but-3-enyl-4-(5,5-difluorohexan-2-yl)benzene.
| Compound Name | 1-but-3-enyl-4-(5,5-difluorohexan-2-yl)benzene |
|---|---|
| PubChem CID | 134342243 |
| Molecular Formula | C16H22F2 |
| Molecular Weight | 252.35 g/mol |
| Exact Mass | 252.17 |
| IUPAC Name | 1-but-3-enyl-4-(5,5-difluorohexan-2-yl)benzene |
| SMILES | C=CCCc1ccc(C(C)CCC(C)(F)F)cc1 |
| InChI | InChI=1S/C16H22F2/c1-4-5-6-14-7-9-15(10-8-14)13(2)11-12-16(3,17)18/h4,7-10,13H,1,5-6,11-12H2,2-3H3 |
| InChIKey | JTOHLGDUXIVDKL-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.35 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|