C22H19F7N4O2 — CID 134346909
7-(dimethylamino)-6-fluoro-4-oxo-N-(4,4,4-trifluoro-2-methylbutan-2-yl)-1-(2,4,6-trifluorophenyl)-1,8-naphthyridine-3-carboxamide (PubChem CID 134346909) has the molecular formula C22H19F7N4O2 and a molecular weight of 504.41 g/mol. Its IUPAC name is 7-(dimethylamino)-6-fluoro-4-oxo-N-(4,4,4-trifluoro-2-methylbutan-2-yl)-1-(2,4,6-trifluorophenyl)-1,8-naphthyridine-3-carboxamide.
| Compound Name | 7-(dimethylamino)-6-fluoro-4-oxo-N-(4,4,4-trifluoro-2-methylbutan-2-yl)-1-(2,4,6-trifluorophenyl)-1,8-naphthyridine-3-carboxamide |
|---|---|
| PubChem CID | 134346909 |
| Molecular Formula | C22H19F7N4O2 |
| Molecular Weight | 504.41 g/mol |
| Exact Mass | 504.14 |
| IUPAC Name | 7-(dimethylamino)-6-fluoro-4-oxo-N-(4,4,4-trifluoro-2-methylbutan-2-yl)-1-(2,4,6-trifluorophenyl)-1,8-naphthyridine-3-carboxamide |
| SMILES | CN(C)c1nc2c(cc1F)c(=O)c(C(=O)NC(C)(C)CC(F)(F)F)cn2-c1c(F)cc(F)cc1F |
| InChI | InChI=1S/C22H19F7N4O2/c1-21(2,9-22(27,28)29)31-20(35)12-8-33(16-13(24)5-10(23)6-14(16)25)18-11(17(12)34)7-15(26)19(30-18)32(3)4/h5-8H,9H2,1-4H3,(H,31,35) |
| InChIKey | PGAZMALMYWWEKV-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.41 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |