C20H12ClF9N4O2 — CID 134360179
1-(2-chloro-4,6-difluorophenyl)-7-(dimethylamino)-6-fluoro-N-(1,1,1,3,3,3-hexafluoropropan-2-yl)-4-oxo-1,8-naphthyridine-3-carboxamide (PubChem CID 134360179) has the molecular formula C20H12ClF9N4O2 and a molecular weight of 546.78 g/mol. Its IUPAC name is 1-(2-chloro-4,6-difluorophenyl)-7-(dimethylamino)-6-fluoro-N-(1,1,1,3,3,3-hexafluoropropan-2-yl)-4-oxo-1,8-naphthyridine-3-carboxamide.
| Compound Name | 1-(2-chloro-4,6-difluorophenyl)-7-(dimethylamino)-6-fluoro-N-(1,1,1,3,3,3-hexafluoropropan-2-yl)-4-oxo-1,8-naphthyridine-3-carboxamide |
|---|---|
| PubChem CID | 134360179 |
| Molecular Formula | C20H12ClF9N4O2 |
| Molecular Weight | 546.78 g/mol |
| Exact Mass | 546.05 |
| IUPAC Name | 1-(2-chloro-4,6-difluorophenyl)-7-(dimethylamino)-6-fluoro-N-(1,1,1,3,3,3-hexafluoropropan-2-yl)-4-oxo-1,8-naphthyridine-3-carboxamide |
| SMILES | CN(C)c1nc2c(cc1F)c(=O)c(C(=O)NC(C(F)(F)F)C(F)(F)F)cn2-c1c(F)cc(F)cc1Cl |
| InChI | InChI=1S/C20H12ClF9N4O2/c1-33(2)16-12(24)5-8-14(35)9(17(36)32-18(19(25,26)27)20(28,29)30)6-34(15(8)31-16)13-10(21)3-7(22)4-11(13)23/h3-6,18H,1-2H3,(H,32,36) |
| InChIKey | QZUCOJMIDPCGOP-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.78 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |