C22H16F10N4O2 — CID 139446118
6-fluoro-7-[methyl(trifluoromethyl)amino]-4-oxo-N-(4,4,4-trifluoro-2-methylbutan-2-yl)-1-(2,4,6-trifluorophenyl)-1,8-naphthyridine-3-carboxamide (PubChem CID 139446118) has the molecular formula C22H16F10N4O2 and a molecular weight of 558.38 g/mol. Its IUPAC name is 6-fluoro-7-[methyl(trifluoromethyl)amino]-4-oxo-N-(4,4,4-trifluoro-2-methylbutan-2-yl)-1-(2,4,6-trifluorophenyl)-1,8-naphthyridine-3-carboxamide.
| Compound Name | 6-fluoro-7-[methyl(trifluoromethyl)amino]-4-oxo-N-(4,4,4-trifluoro-2-methylbutan-2-yl)-1-(2,4,6-trifluorophenyl)-1,8-naphthyridine-3-carboxamide |
|---|---|
| PubChem CID | 139446118 |
| Molecular Formula | C22H16F10N4O2 |
| Molecular Weight | 558.38 g/mol |
| Exact Mass | 558.11 |
| IUPAC Name | 6-fluoro-7-[methyl(trifluoromethyl)amino]-4-oxo-N-(4,4,4-trifluoro-2-methylbutan-2-yl)-1-(2,4,6-trifluorophenyl)-1,8-naphthyridine-3-carboxamide |
| SMILES | CN(c1nc2c(cc1F)c(=O)c(C(=O)NC(C)(C)CC(F)(F)F)cn2-c1c(F)cc(F)cc1F)C(F)(F)F |
| InChI | InChI=1S/C22H16F10N4O2/c1-20(2,8-21(27,28)29)34-19(38)11-7-36(15-12(24)4-9(23)5-13(15)25)17-10(16(11)37)6-14(26)18(33-17)35(3)22(30,31)32/h4-7H,8H2,1-3H3,(H,34,38) |
| InChIKey | YAJAWALYNOWIIK-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.38 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|