C23H23F5N4O2 — CID 135354804
1-(2,4-difluorophenyl)-7-(dimethylamino)-4-oxo-N-[(2S)-1,1,1-trifluoro-3,3-dimethylbutan-2-yl]-1,8-naphthyridine-3-carboxamide (PubChem CID 135354804) has the molecular formula C23H23F5N4O2 and a molecular weight of 482.45 g/mol. Its IUPAC name is 1-(2,4-difluorophenyl)-7-(dimethylamino)-4-oxo-N-[(2S)-1,1,1-trifluoro-3,3-dimethylbutan-2-yl]-1,8-naphthyridine-3-carboxamide.
| Compound Name | 1-(2,4-difluorophenyl)-7-(dimethylamino)-4-oxo-N-[(2S)-1,1,1-trifluoro-3,3-dimethylbutan-2-yl]-1,8-naphthyridine-3-carboxamide |
|---|---|
| PubChem CID | 135354804 |
| Molecular Formula | C23H23F5N4O2 |
| Molecular Weight | 482.45 g/mol |
| Exact Mass | 482.17 |
| IUPAC Name | 1-(2,4-difluorophenyl)-7-(dimethylamino)-4-oxo-N-[(2S)-1,1,1-trifluoro-3,3-dimethylbutan-2-yl]-1,8-naphthyridine-3-carboxamide |
| SMILES | CN(C)c1ccc2c(=O)c(C(=O)N[C@@H](C(C)(C)C)C(F)(F)F)cn(-c3ccc(F)cc3F)c2n1 |
| InChI | InChI=1S/C23H23F5N4O2/c1-22(2,3)21(23(26,27)28)30-20(34)14-11-32(16-8-6-12(24)10-15(16)25)19-13(18(14)33)7-9-17(29-19)31(4)5/h6-11,21H,1-5H3,(H,30,34)/t21-/m0/s1 |
| InChIKey | GDPUOGVJZRWMIJ-NRFANRHFSA-N |
| XLogP | 4.44 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.45 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |