C23H14F10N4O3 — CID 134360099
6-fluoro-N-(1,1,1,3,3,3-hexafluoropropan-2-yl)-7-(2-oxa-6-azaspiro[3.3]heptan-6-yl)-4-oxo-1-(2,4,6-trifluorophenyl)-1,8-naphthyridine-3-carboxamide (PubChem CID 134360099) has the molecular formula C23H14F10N4O3 and a molecular weight of 584.37 g/mol. Its IUPAC name is 6-fluoro-N-(1,1,1,3,3,3-hexafluoropropan-2-yl)-7-(2-oxa-6-azaspiro[3.3]heptan-6-yl)-4-oxo-1-(2,4,6-trifluorophenyl)-1,8-naphthyridine-3-carboxamide.
| Compound Name | 6-fluoro-N-(1,1,1,3,3,3-hexafluoropropan-2-yl)-7-(2-oxa-6-azaspiro[3.3]heptan-6-yl)-4-oxo-1-(2,4,6-trifluorophenyl)-1,8-naphthyridine-3-carboxamide |
|---|---|
| PubChem CID | 134360099 |
| Molecular Formula | C23H14F10N4O3 |
| Molecular Weight | 584.37 g/mol |
| Exact Mass | 584.09 |
| IUPAC Name | 6-fluoro-N-(1,1,1,3,3,3-hexafluoropropan-2-yl)-7-(2-oxa-6-azaspiro[3.3]heptan-6-yl)-4-oxo-1-(2,4,6-trifluorophenyl)-1,8-naphthyridine-3-carboxamide |
| SMILES | O=C(NC(C(F)(F)F)C(F)(F)F)c1cn(-c2c(F)cc(F)cc2F)c2nc(N3CC4(COC4)C3)c(F)cc2c1=O |
| InChI | InChI=1S/C23H14F10N4O3/c24-9-1-12(25)15(13(26)2-9)37-4-11(19(39)35-20(22(28,29)30)23(31,32)33)16(38)10-3-14(27)18(34-17(10)37)36-5-21(6-36)7-40-8-21/h1-4,20H,5-8H2,(H,35,39) |
| InChIKey | DBYVZXWXSMIFAD-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 76.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.37 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |