C11H14Cl2O4 — CID 134356786
dimethyl 4,4-dichloro-5-methylcyclohexene-1,2-dicarboxylate (PubChem CID 134356786) has the molecular formula C11H14Cl2O4 and a molecular weight of 281.13 g/mol. Its IUPAC name is dimethyl 4,4-dichloro-5-methylcyclohexene-1,2-dicarboxylate.
| Compound Name | dimethyl 4,4-dichloro-5-methylcyclohexene-1,2-dicarboxylate |
|---|---|
| PubChem CID | 134356786 |
| Molecular Formula | C11H14Cl2O4 |
| Molecular Weight | 281.13 g/mol |
| Exact Mass | 280.03 |
| IUPAC Name | dimethyl 4,4-dichloro-5-methylcyclohexene-1,2-dicarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)CC(Cl)(Cl)C(C)C1 |
| InChI | InChI=1S/C11H14Cl2O4/c1-6-4-7(9(14)16-2)8(10(15)17-3)5-11(6,12)13/h6H,4-5H2,1-3H3 |
| InChIKey | KNDNNXNOPCMEHO-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.13 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|