C9H10ClNO4 — CID 155031471
dimethyl 2-chloro-2,3-dihydropyridine-4,5-dicarboxylate (PubChem CID 155031471) has the molecular formula C9H10ClNO4 and a molecular weight of 231.63 g/mol. Its IUPAC name is dimethyl 2-chloro-2,3-dihydropyridine-4,5-dicarboxylate.
| Compound Name | dimethyl 2-chloro-2,3-dihydropyridine-4,5-dicarboxylate |
|---|---|
| PubChem CID | 155031471 |
| Molecular Formula | C9H10ClNO4 |
| Molecular Weight | 231.63 g/mol |
| Exact Mass | 231.03 |
| IUPAC Name | dimethyl 2-chloro-2,3-dihydropyridine-4,5-dicarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)CC(Cl)N=C1 |
| InChI | InChI=1S/C9H10ClNO4/c1-14-8(12)5-3-7(10)11-4-6(5)9(13)15-2/h4,7H,3H2,1-2H3 |
| InChIKey | YXSDBFLAFKKZFE-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 64.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.63 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|