C12H17NO — CID 134357155
(9S)-9-(nitrosomethyl)-3,4,4a,5,8,9-hexahydro-2H-benzo[7]annulene (PubChem CID 134357155) has the molecular formula C12H17NO and a molecular weight of 191.27 g/mol. Its IUPAC name is (9S)-9-(nitrosomethyl)-3,4,4a,5,8,9-hexahydro-2H-benzo[7]annulene.
| Compound Name | (9S)-9-(nitrosomethyl)-3,4,4a,5,8,9-hexahydro-2H-benzo[7]annulene |
|---|---|
| PubChem CID | 134357155 |
| Molecular Formula | C12H17NO |
| Molecular Weight | 191.27 g/mol |
| Exact Mass | 191.13 |
| IUPAC Name | (9S)-9-(nitrosomethyl)-3,4,4a,5,8,9-hexahydro-2H-benzo[7]annulene |
| SMILES | O=NC[C@H]1CC=CCC2CCCC=C21 |
| InChI | InChI=1S/C12H17NO/c14-13-9-11-7-2-1-5-10-6-3-4-8-12(10)11/h1-2,8,10-11H,3-7,9H2/t10?,11-/m1/s1 |
| InChIKey | BPYUULJRARJNEP-RRKGBCIJSA-N |
| XLogP | 3.45 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.27 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|