C12H15N7O3 — CID 134357723
3-methyl-N-[2-(2-methylprop-2-enoylamino)ethyl]-4-oxoimidazo[5,1-d][1,2,3,5]tetrazine-8-carboxamide (PubChem CID 134357723) has the molecular formula C12H15N7O3 and a molecular weight of 305.30 g/mol. Its IUPAC name is 3-methyl-N-[2-(2-methylprop-2-enoylamino)ethyl]-4-oxoimidazo[5,1-d][1,2,3,5]tetrazine-8-carboxamide.
| Compound Name | 3-methyl-N-[2-(2-methylprop-2-enoylamino)ethyl]-4-oxoimidazo[5,1-d][1,2,3,5]tetrazine-8-carboxamide |
|---|---|
| PubChem CID | 134357723 |
| Molecular Formula | C12H15N7O3 |
| Molecular Weight | 305.30 g/mol |
| Exact Mass | 305.12 |
| IUPAC Name | 3-methyl-N-[2-(2-methylprop-2-enoylamino)ethyl]-4-oxoimidazo[5,1-d][1,2,3,5]tetrazine-8-carboxamide |
| SMILES | C=C(C)C(=O)NCCNC(=O)c1ncn2c(=O)n(C)nnc12 |
| InChI | InChI=1S/C12H15N7O3/c1-7(2)10(20)13-4-5-14-11(21)8-9-16-17-18(3)12(22)19(9)6-15-8/h6H,1,4-5H2,2-3H3,(H,13,20)(H,14,21) |
| InChIKey | WVAXYXZACQIFAZ-UHFFFAOYSA-N |
| XLogP | -1.75 |
| TPSA | 123.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.30 |
| LogP ≤ 5 | -1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|