C12H14N6O3 — CID 148722507
3-methyl-4-oxo-N-(4-oxohex-5-enyl)imidazo[5,1-d][1,2,3,5]tetrazine-8-carboxamide (PubChem CID 148722507) has the molecular formula C12H14N6O3 and a molecular weight of 290.28 g/mol. Its IUPAC name is 3-methyl-4-oxo-N-(4-oxohex-5-enyl)imidazo[5,1-d][1,2,3,5]tetrazine-8-carboxamide.
| Compound Name | 3-methyl-4-oxo-N-(4-oxohex-5-enyl)imidazo[5,1-d][1,2,3,5]tetrazine-8-carboxamide |
|---|---|
| PubChem CID | 148722507 |
| Molecular Formula | C12H14N6O3 |
| Molecular Weight | 290.28 g/mol |
| Exact Mass | 290.11 |
| IUPAC Name | 3-methyl-4-oxo-N-(4-oxohex-5-enyl)imidazo[5,1-d][1,2,3,5]tetrazine-8-carboxamide |
| SMILES | C=CC(=O)CCCNC(=O)c1ncn2c(=O)n(C)nnc12 |
| InChI | InChI=1S/C12H14N6O3/c1-3-8(19)5-4-6-13-11(20)9-10-15-16-17(2)12(21)18(10)7-14-9/h3,7H,1,4-6H2,2H3,(H,13,20) |
| InChIKey | NZIXMAAJTWQEMD-UHFFFAOYSA-N |
| XLogP | -0.91 |
| TPSA | 111.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.28 |
| LogP ≤ 5 | -0.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|