C81H72N4 — CID 134360445
2-N'-[(2E)-5-methylhexa-2,4-dien-2-yl]-2-N,2-N,2-N',7-N,7-N,7-N',7-N'-heptakis(4-methylphenyl)-9,9'-spirobi[fluorene]-2,2',7,7'-tetramine (PubChem CID 134360445) has the molecular formula C81H72N4 and a molecular weight of 1101.49 g/mol. Its IUPAC name is 2-N'-[(2E)-5-methylhexa-2,4-dien-2-yl]-2-N,2-N,2-N',7-N,7-N,7-N',7-N'-heptakis(4-methylphenyl)-9,9'-spirobi[fluorene]-2,2',7,7'-tetramine.
| Compound Name | 2-N'-[(2E)-5-methylhexa-2,4-dien-2-yl]-2-N,2-N,2-N',7-N,7-N,7-N',7-N'-heptakis(4-methylphenyl)-9,9'-spirobi[fluorene]-2,2',7,7'-tetramine |
|---|---|
| PubChem CID | 134360445 |
| Molecular Formula | C81H72N4 |
| Molecular Weight | 1101.49 g/mol |
| Exact Mass | 1100.58 |
| IUPAC Name | 2-N'-[(2E)-5-methylhexa-2,4-dien-2-yl]-2-N,2-N,2-N',7-N,7-N,7-N',7-N'-heptakis(4-methylphenyl)-9,9'-spirobi[fluorene]-2,2',7,7'-tetramine |
| SMILES | CC(C)=C/C=C(\C)N(c1ccc(C)cc1)c1ccc2c(c1)C1(c3cc(N(c4ccc(C)cc4)c4ccc(C)cc4)ccc3-2)c2cc(N(c3ccc(C)cc3)c3ccc(C)cc3)ccc2-c2ccc(N(c3ccc(C)cc3)c3ccc(C)cc3)cc21 |
| InChI | InChI=1S/C81H72N4/c1-53(2)11-26-61(10)82(62-27-12-54(3)13-28-62)69-41-45-73-74-46-42-70(83(63-29-14-55(4)15-30-63)64-31-16-56(5)17-32-64)50-78(74)81(77(73)49-69)79-51-71(84(65-33-18-57(6)19-34-65)66-35-20-58(7)21-36-66)43-47-75(79)76-48-44-72(52-80(76)81)85(67-37-22-59(8)23-38-67)68-39-24-60(9)25-40-68/h11-52H,1-10H3/b61-26+ |
| InChIKey | FZXZUJUQHIXZJT-VYFHDEQZSA-N |
| XLogP | 22.61 |
| TPSA | 12.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 85 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1101.49 |
| LogP ≤ 5 | 22.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|