C11H15FIN — CID 134365792
4-(4-fluorocyclohexa-1,3-dien-1-yl)-1-iodopiperidine (PubChem CID 134365792) has the molecular formula C11H15FIN and a molecular weight of 307.15 g/mol. Its IUPAC name is 4-(4-fluorocyclohexa-1,3-dien-1-yl)-1-iodopiperidine.
| Compound Name | 4-(4-fluorocyclohexa-1,3-dien-1-yl)-1-iodopiperidine |
|---|---|
| PubChem CID | 134365792 |
| Molecular Formula | C11H15FIN |
| Molecular Weight | 307.15 g/mol |
| Exact Mass | 307.02 |
| IUPAC Name | 4-(4-fluorocyclohexa-1,3-dien-1-yl)-1-iodopiperidine |
| SMILES | FC1=CC=C(C2CCN(I)CC2)CC1 |
| InChI | InChI=1S/C11H15FIN/c12-11-3-1-9(2-4-11)10-5-7-14(13)8-6-10/h1,3,10H,2,4-8H2 |
| InChIKey | UVDDEJDTIGAFBL-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.15 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|