C15H12Cl2F3N5O2 — CID 134367827
4-[5,6-dichloro-2-(2-fluoro-4-pyridinyl)pyrimidin-4-yl]-6,6-difluoro-1,4-diazepane-1-carboxylic acid (PubChem CID 134367827) has the molecular formula C15H12Cl2F3N5O2 and a molecular weight of 422.19 g/mol. Its IUPAC name is 4-[5,6-dichloro-2-(2-fluoro-4-pyridinyl)pyrimidin-4-yl]-6,6-difluoro-1,4-diazepane-1-carboxylic acid.
| Compound Name | 4-[5,6-dichloro-2-(2-fluoro-4-pyridinyl)pyrimidin-4-yl]-6,6-difluoro-1,4-diazepane-1-carboxylic acid |
|---|---|
| PubChem CID | 134367827 |
| Molecular Formula | C15H12Cl2F3N5O2 |
| Molecular Weight | 422.19 g/mol |
| Exact Mass | 421.03 |
| IUPAC Name | 4-[5,6-dichloro-2-(2-fluoro-4-pyridinyl)pyrimidin-4-yl]-6,6-difluoro-1,4-diazepane-1-carboxylic acid |
| SMILES | O=C(O)N1CCN(c2nc(-c3ccnc(F)c3)nc(Cl)c2Cl)CC(F)(F)C1 |
| InChI | InChI=1S/C15H12Cl2F3N5O2/c16-10-11(17)22-12(8-1-2-21-9(18)5-8)23-13(10)24-3-4-25(14(26)27)7-15(19,20)6-24/h1-2,5H,3-4,6-7H2,(H,26,27) |
| InChIKey | BACYZIISBNJNSJ-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 82.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.19 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|